C23H25N7OS2 — CID 145104085
4-[2-[1-[(4-methoxyphenyl)methyl]-3,5-dimethylpyrazol-4-yl]-1,3-thiazol-4-yl]-N-(1,4,5,6-tetrahydropyrimidin-2-yl)-1,3-thiazol-2-amine (PubChem CID 145104085) has the molecular formula C23H25N7OS2 and a molecular weight of 479.64 g/mol. Its IUPAC name is 4-[2-[1-[(4-methoxyphenyl)methyl]-3,5-dimethylpyrazol-4-yl]-1,3-thiazol-4-yl]-N-(1,4,5,6-tetrahydropyrimidin-2-yl)-1,3-thiazol-2-amine.
| Compound Name | 4-[2-[1-[(4-methoxyphenyl)methyl]-3,5-dimethylpyrazol-4-yl]-1,3-thiazol-4-yl]-N-(1,4,5,6-tetrahydropyrimidin-2-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 145104085 |
| Molecular Formula | C23H25N7OS2 |
| Molecular Weight | 479.64 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | 4-[2-[1-[(4-methoxyphenyl)methyl]-3,5-dimethylpyrazol-4-yl]-1,3-thiazol-4-yl]-N-(1,4,5,6-tetrahydropyrimidin-2-yl)-1,3-thiazol-2-amine |
| SMILES | COc1ccc(Cn2nc(C)c(-c3nc(-c4csc(NC5=NCCCN5)n4)cs3)c2C)cc1 |
| InChI | InChI=1S/C23H25N7OS2/c1-14-20(15(2)30(29-14)11-16-5-7-17(31-3)8-6-16)21-26-18(12-32-21)19-13-33-23(27-19)28-22-24-9-4-10-25-22/h5-8,12-13H,4,9-11H2,1-3H3,(H2,24,25,27,28) |
| InChIKey | KBSNLYNOYVPCON-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 89.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.64 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |