C18H23N7OS — CID 145105067
4-[6-(4-methoxyiminopiperidin-1-yl)-2-pyridinyl]-N-(1,4,5,6-tetrahydropyrimidin-2-yl)-1,3-thiazol-2-amine (PubChem CID 145105067) has the molecular formula C18H23N7OS and a molecular weight of 385.50 g/mol. Its IUPAC name is 4-[6-(4-methoxyiminopiperidin-1-yl)-2-pyridinyl]-N-(1,4,5,6-tetrahydropyrimidin-2-yl)-1,3-thiazol-2-amine.
| Compound Name | 4-[6-(4-methoxyiminopiperidin-1-yl)-2-pyridinyl]-N-(1,4,5,6-tetrahydropyrimidin-2-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 145105067 |
| Molecular Formula | C18H23N7OS |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 4-[6-(4-methoxyiminopiperidin-1-yl)-2-pyridinyl]-N-(1,4,5,6-tetrahydropyrimidin-2-yl)-1,3-thiazol-2-amine |
| SMILES | CON=C1CCN(c2cccc(-c3csc(NC4=NCCCN4)n3)n2)CC1 |
| InChI | InChI=1S/C18H23N7OS/c1-26-24-13-6-10-25(11-7-13)16-5-2-4-14(21-16)15-12-27-18(22-15)23-17-19-8-3-9-20-17/h2,4-5,12H,3,6-11H2,1H3,(H2,19,20,22,23) |
| InChIKey | HLQBXRIMKHMBLG-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|