C20H27N7OS — CID 145104207
4-[6-(4-propan-2-yloxyiminopiperidin-1-yl)-2-pyridinyl]-N-(1,4,5,6-tetrahydropyrimidin-2-yl)-1,3-thiazol-2-amine (PubChem CID 145104207) has the molecular formula C20H27N7OS and a molecular weight of 413.55 g/mol. Its IUPAC name is 4-[6-(4-propan-2-yloxyiminopiperidin-1-yl)-2-pyridinyl]-N-(1,4,5,6-tetrahydropyrimidin-2-yl)-1,3-thiazol-2-amine.
| Compound Name | 4-[6-(4-propan-2-yloxyiminopiperidin-1-yl)-2-pyridinyl]-N-(1,4,5,6-tetrahydropyrimidin-2-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 145104207 |
| Molecular Formula | C20H27N7OS |
| Molecular Weight | 413.55 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | 4-[6-(4-propan-2-yloxyiminopiperidin-1-yl)-2-pyridinyl]-N-(1,4,5,6-tetrahydropyrimidin-2-yl)-1,3-thiazol-2-amine |
| SMILES | CC(C)ON=C1CCN(c2cccc(-c3csc(NC4=NCCCN4)n3)n2)CC1 |
| InChI | InChI=1S/C20H27N7OS/c1-14(2)28-26-15-7-11-27(12-8-15)18-6-3-5-16(23-18)17-13-29-20(24-17)25-19-21-9-4-10-22-19/h3,5-6,13-14H,4,7-12H2,1-2H3,(H2,21,22,24,25) |
| InChIKey | XTTDJKCFNUWWRR-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.55 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|