C22H24N4OS — CID 132601874
4-[2-(2,4-dimethylphenoxy)phenyl]-N-(4,5,6,7-tetrahydro-1H-1,3-diazepin-2-yl)-1,3-thiazol-2-amine (PubChem CID 132601874) has the molecular formula C22H24N4OS and a molecular weight of 392.53 g/mol. Its IUPAC name is 4-[2-(2,4-dimethylphenoxy)phenyl]-N-(4,5,6,7-tetrahydro-1H-1,3-diazepin-2-yl)-1,3-thiazol-2-amine.
| Compound Name | 4-[2-(2,4-dimethylphenoxy)phenyl]-N-(4,5,6,7-tetrahydro-1H-1,3-diazepin-2-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 132601874 |
| Molecular Formula | C22H24N4OS |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 4-[2-(2,4-dimethylphenoxy)phenyl]-N-(4,5,6,7-tetrahydro-1H-1,3-diazepin-2-yl)-1,3-thiazol-2-amine |
| SMILES | Cc1ccc(Oc2ccccc2-c2csc(NC3=NCCCCN3)n2)c(C)c1 |
| InChI | InChI=1S/C22H24N4OS/c1-15-9-10-19(16(2)13-15)27-20-8-4-3-7-17(20)18-14-28-22(25-18)26-21-23-11-5-6-12-24-21/h3-4,7-10,13-14H,5-6,11-12H2,1-2H3,(H2,23,24,25,26) |
| InChIKey | BQJTVGBPKUYYGY-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |