C20H17F2N3OS — CID 123536502
4-[2-(3,4-difluorophenoxy)phenyl]-N-(2,3,4,5-tetrahydropyridin-6-yl)-1,3-thiazol-2-amine (PubChem CID 123536502) has the molecular formula C20H17F2N3OS and a molecular weight of 385.44 g/mol. Its IUPAC name is 4-[2-(3,4-difluorophenoxy)phenyl]-N-(2,3,4,5-tetrahydropyridin-6-yl)-1,3-thiazol-2-amine.
| Compound Name | 4-[2-(3,4-difluorophenoxy)phenyl]-N-(2,3,4,5-tetrahydropyridin-6-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 123536502 |
| Molecular Formula | C20H17F2N3OS |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 4-[2-(3,4-difluorophenoxy)phenyl]-N-(2,3,4,5-tetrahydropyridin-6-yl)-1,3-thiazol-2-amine |
| SMILES | Fc1ccc(Oc2ccccc2-c2csc(NC3=NCCCC3)n2)cc1F |
| InChI | InChI=1S/C20H17F2N3OS/c21-15-9-8-13(11-16(15)22)26-18-6-2-1-5-14(18)17-12-27-20(24-17)25-19-7-3-4-10-23-19/h1-2,5-6,8-9,11-12H,3-4,7,10H2,(H,23,24,25) |
| InChIKey | YPEKKGNMVATDFK-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |