C13H13ClN4S — CID 87196759
4-(2-chloro-3-pyridinyl)-N-(2,3,4,5-tetrahydropyridin-6-yl)-1,3-thiazol-2-amine (PubChem CID 87196759) has the molecular formula C13H13ClN4S and a molecular weight of 292.80 g/mol. Its IUPAC name is 4-(2-chloro-3-pyridinyl)-N-(2,3,4,5-tetrahydropyridin-6-yl)-1,3-thiazol-2-amine.
| Compound Name | 4-(2-chloro-3-pyridinyl)-N-(2,3,4,5-tetrahydropyridin-6-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 87196759 |
| Molecular Formula | C13H13ClN4S |
| Molecular Weight | 292.80 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 4-(2-chloro-3-pyridinyl)-N-(2,3,4,5-tetrahydropyridin-6-yl)-1,3-thiazol-2-amine |
| SMILES | Clc1ncccc1-c1csc(NC2=NCCCC2)n1 |
| InChI | InChI=1S/C13H13ClN4S/c14-12-9(4-3-7-16-12)10-8-19-13(17-10)18-11-5-1-2-6-15-11/h3-4,7-8H,1-2,5-6H2,(H,15,17,18) |
| InChIKey | VKUXQCUDKAOXDK-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.80 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|