C19H17Cl2N5OS — CID 145104213
4-[2-[(2,4-dichlorophenyl)methoxy]-3-pyridinyl]-N-(1,4,5,6-tetrahydropyrimidin-2-yl)-1,3-thiazol-2-amine (PubChem CID 145104213) has the molecular formula C19H17Cl2N5OS and a molecular weight of 434.35 g/mol. Its IUPAC name is 4-[2-[(2,4-dichlorophenyl)methoxy]-3-pyridinyl]-N-(1,4,5,6-tetrahydropyrimidin-2-yl)-1,3-thiazol-2-amine.
| Compound Name | 4-[2-[(2,4-dichlorophenyl)methoxy]-3-pyridinyl]-N-(1,4,5,6-tetrahydropyrimidin-2-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 145104213 |
| Molecular Formula | C19H17Cl2N5OS |
| Molecular Weight | 434.35 g/mol |
| Exact Mass | 433.05 |
| IUPAC Name | 4-[2-[(2,4-dichlorophenyl)methoxy]-3-pyridinyl]-N-(1,4,5,6-tetrahydropyrimidin-2-yl)-1,3-thiazol-2-amine |
| SMILES | Clc1ccc(COc2ncccc2-c2csc(NC3=NCCCN3)n2)c(Cl)c1 |
| InChI | InChI=1S/C19H17Cl2N5OS/c20-13-5-4-12(15(21)9-13)10-27-17-14(3-1-6-22-17)16-11-28-19(25-16)26-18-23-7-2-8-24-18/h1,3-6,9,11H,2,7-8,10H2,(H2,23,24,25,26) |
| InChIKey | VBEDAZSJFUXCJN-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 71.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.35 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |