C17H19N7S2 — CID 145104831
4-[6-[methyl(1,3-thiazol-4-ylmethyl)amino]-2-pyridinyl]-N-(1,4,5,6-tetrahydropyrimidin-2-yl)-1,3-thiazol-2-amine (PubChem CID 145104831) has the molecular formula C17H19N7S2 and a molecular weight of 385.52 g/mol. Its IUPAC name is 4-[6-[methyl(1,3-thiazol-4-ylmethyl)amino]-2-pyridinyl]-N-(1,4,5,6-tetrahydropyrimidin-2-yl)-1,3-thiazol-2-amine.
| Compound Name | 4-[6-[methyl(1,3-thiazol-4-ylmethyl)amino]-2-pyridinyl]-N-(1,4,5,6-tetrahydropyrimidin-2-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 145104831 |
| Molecular Formula | C17H19N7S2 |
| Molecular Weight | 385.52 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 4-[6-[methyl(1,3-thiazol-4-ylmethyl)amino]-2-pyridinyl]-N-(1,4,5,6-tetrahydropyrimidin-2-yl)-1,3-thiazol-2-amine |
| SMILES | CN(Cc1cscn1)c1cccc(-c2csc(NC3=NCCCN3)n2)n1 |
| InChI | InChI=1S/C17H19N7S2/c1-24(8-12-9-25-11-20-12)15-5-2-4-13(21-15)14-10-26-17(22-14)23-16-18-6-3-7-19-16/h2,4-5,9-11H,3,6-8H2,1H3,(H2,18,19,22,23) |
| InChIKey | XCFYGBKUKUCHHC-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 78.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.52 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |