C11H12BrN3O2S2 — CID 18870687
4-(4-bromophenyl)-2-(dimethylsulfamoylamino)-1,3-thiazole (PubChem CID 18870687) has the molecular formula C11H12BrN3O2S2 and a molecular weight of 362.27 g/mol. Its IUPAC name is 4-(4-bromophenyl)-2-(dimethylsulfamoylamino)-1,3-thiazole.
| Compound Name | 4-(4-bromophenyl)-2-(dimethylsulfamoylamino)-1,3-thiazole |
|---|---|
| PubChem CID | 18870687 |
| Molecular Formula | C11H12BrN3O2S2 |
| Molecular Weight | 362.27 g/mol |
| Exact Mass | 360.96 |
| IUPAC Name | 4-(4-bromophenyl)-2-(dimethylsulfamoylamino)-1,3-thiazole |
| SMILES | CN(C)S(=O)(=O)Nc1nc(-c2ccc(Br)cc2)cs1 |
| InChI | InChI=1S/C11H12BrN3O2S2/c1-15(2)19(16,17)14-11-13-10(7-18-11)8-3-5-9(12)6-4-8/h3-7H,1-2H3,(H,13,14) |
| InChIKey | VOASSJOXCAQMFF-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.27 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |