C17H11ClN2O2S2 — CID 16934053
N-benzo[g][1,3]benzothiazol-2-yl-4-chlorobenzenesulfonamide (PubChem CID 16934053) has the molecular formula C17H11ClN2O2S2 and a molecular weight of 374.87 g/mol. Its IUPAC name is N-benzo[g][1,3]benzothiazol-2-yl-4-chlorobenzenesulfonamide.
| Compound Name | N-benzo[g][1,3]benzothiazol-2-yl-4-chlorobenzenesulfonamide |
|---|---|
| PubChem CID | 16934053 |
| Molecular Formula | C17H11ClN2O2S2 |
| Molecular Weight | 374.87 g/mol |
| Exact Mass | 374.00 |
| IUPAC Name | N-benzo[g][1,3]benzothiazol-2-yl-4-chlorobenzenesulfonamide |
| SMILES | O=S(=O)(Nc1nc2ccc3ccccc3c2s1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H11ClN2O2S2/c18-12-6-8-13(9-7-12)24(21,22)20-17-19-15-10-5-11-3-1-2-4-14(11)16(15)23-17/h1-10H,(H,19,20) |
| InChIKey | DVDOAAWXDQNXNM-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.87 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |