C18H17BrN2O4S2 — CID 55913944
5-bromo-N-[[2-(4-ethoxyphenoxy)-4-pyridinyl]methyl]thiophene-2-sulfonamide (PubChem CID 55913944) has the molecular formula C18H17BrN2O4S2 and a molecular weight of 469.38 g/mol. Its IUPAC name is 5-bromo-N-[[2-(4-ethoxyphenoxy)-4-pyridinyl]methyl]thiophene-2-sulfonamide.
| Compound Name | 5-bromo-N-[[2-(4-ethoxyphenoxy)-4-pyridinyl]methyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 55913944 |
| Molecular Formula | C18H17BrN2O4S2 |
| Molecular Weight | 469.38 g/mol |
| Exact Mass | 467.98 |
| IUPAC Name | 5-bromo-N-[[2-(4-ethoxyphenoxy)-4-pyridinyl]methyl]thiophene-2-sulfonamide |
| SMILES | CCOc1ccc(Oc2cc(CNS(=O)(=O)c3ccc(Br)s3)ccn2)cc1 |
| InChI | InChI=1S/C18H17BrN2O4S2/c1-2-24-14-3-5-15(6-4-14)25-17-11-13(9-10-20-17)12-21-27(22,23)18-8-7-16(19)26-18/h3-11,21H,2,12H2,1H3 |
| InChIKey | MMLDGNPWPIYSOU-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.38 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |