C13H17N3O3S2 — CID 106062054
N-[(2-methoxy-4-pyridinyl)methyl]-5-(methylaminomethyl)thiophene-2-sulfonamide (PubChem CID 106062054) has the molecular formula C13H17N3O3S2 and a molecular weight of 327.43 g/mol. Its IUPAC name is N-[(2-methoxy-4-pyridinyl)methyl]-5-(methylaminomethyl)thiophene-2-sulfonamide.
| Compound Name | N-[(2-methoxy-4-pyridinyl)methyl]-5-(methylaminomethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106062054 |
| Molecular Formula | C13H17N3O3S2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | N-[(2-methoxy-4-pyridinyl)methyl]-5-(methylaminomethyl)thiophene-2-sulfonamide |
| SMILES | CNCc1ccc(S(=O)(=O)NCc2ccnc(OC)c2)s1 |
| InChI | InChI=1S/C13H17N3O3S2/c1-14-9-11-3-4-13(20-11)21(17,18)16-8-10-5-6-15-12(7-10)19-2/h3-7,14,16H,8-9H2,1-2H3 |
| InChIKey | PEKCRVHZTYFXQZ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |