C14H16N2O5S2 — CID 55559063
N-[(2-methoxy-4-pyridinyl)methyl]-3-methylsulfonylbenzenesulfonamide (PubChem CID 55559063) has the molecular formula C14H16N2O5S2 and a molecular weight of 356.43 g/mol. Its IUPAC name is N-[(2-methoxy-4-pyridinyl)methyl]-3-methylsulfonylbenzenesulfonamide.
| Compound Name | N-[(2-methoxy-4-pyridinyl)methyl]-3-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 55559063 |
| Molecular Formula | C14H16N2O5S2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | N-[(2-methoxy-4-pyridinyl)methyl]-3-methylsulfonylbenzenesulfonamide |
| SMILES | COc1cc(CNS(=O)(=O)c2cccc(S(C)(=O)=O)c2)ccn1 |
| InChI | InChI=1S/C14H16N2O5S2/c1-21-14-8-11(6-7-15-14)10-16-23(19,20)13-5-3-4-12(9-13)22(2,17)18/h3-9,16H,10H2,1-2H3 |
| InChIKey | YDFNUNXPCQCFAB-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |