C13H17N3O4S — CID 106062062
5-(aminomethyl)-N-[(2-methoxy-4-pyridinyl)methyl]-2-methylfuran-3-sulfonamide (PubChem CID 106062062) has the molecular formula C13H17N3O4S and a molecular weight of 311.36 g/mol. Its IUPAC name is 5-(aminomethyl)-N-[(2-methoxy-4-pyridinyl)methyl]-2-methylfuran-3-sulfonamide.
| Compound Name | 5-(aminomethyl)-N-[(2-methoxy-4-pyridinyl)methyl]-2-methylfuran-3-sulfonamide |
|---|---|
| PubChem CID | 106062062 |
| Molecular Formula | C13H17N3O4S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 5-(aminomethyl)-N-[(2-methoxy-4-pyridinyl)methyl]-2-methylfuran-3-sulfonamide |
| SMILES | COc1cc(CNS(=O)(=O)c2cc(CN)oc2C)ccn1 |
| InChI | InChI=1S/C13H17N3O4S/c1-9-12(6-11(7-14)20-9)21(17,18)16-8-10-3-4-15-13(5-10)19-2/h3-6,16H,7-8,14H2,1-2H3 |
| InChIKey | LSAJJSOFTKPZFR-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 107.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |