C13H16N4O3S — CID 106594468
2-(aminomethyl)-N-[(2-methoxy-4-pyridinyl)methyl]pyridine-3-sulfonamide (PubChem CID 106594468) has the molecular formula C13H16N4O3S and a molecular weight of 308.36 g/mol. Its IUPAC name is 2-(aminomethyl)-N-[(2-methoxy-4-pyridinyl)methyl]pyridine-3-sulfonamide.
| Compound Name | 2-(aminomethyl)-N-[(2-methoxy-4-pyridinyl)methyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 106594468 |
| Molecular Formula | C13H16N4O3S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 2-(aminomethyl)-N-[(2-methoxy-4-pyridinyl)methyl]pyridine-3-sulfonamide |
| SMILES | COc1cc(CNS(=O)(=O)c2cccnc2CN)ccn1 |
| InChI | InChI=1S/C13H16N4O3S/c1-20-13-7-10(4-6-16-13)9-17-21(18,19)12-3-2-5-15-11(12)8-14/h2-7,17H,8-9,14H2,1H3 |
| InChIKey | OYKVKSMACHJZID-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |