C17H22ClN3O3 — CID 120703944
N-[[2-(4-ethoxyphenoxy)-4-pyridinyl]methyl]-2-(methylamino)acetamide;hydrochloride (PubChem CID 120703944) has the molecular formula C17H22ClN3O3 and a molecular weight of 351.83 g/mol. Its IUPAC name is N-[[2-(4-ethoxyphenoxy)-4-pyridinyl]methyl]-2-(methylamino)acetamide;hydrochloride.
| Compound Name | N-[[2-(4-ethoxyphenoxy)-4-pyridinyl]methyl]-2-(methylamino)acetamide;hydrochloride |
|---|---|
| PubChem CID | 120703944 |
| Molecular Formula | C17H22ClN3O3 |
| Molecular Weight | 351.83 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | N-[[2-(4-ethoxyphenoxy)-4-pyridinyl]methyl]-2-(methylamino)acetamide;hydrochloride |
| SMILES | CCOc1ccc(Oc2cc(CNC(=O)CNC)ccn2)cc1.Cl |
| InChI | InChI=1S/C17H21N3O3.ClH/c1-3-22-14-4-6-15(7-5-14)23-17-10-13(8-9-19-17)11-20-16(21)12-18-2;/h4-10,18H,3,11-12H2,1-2H3,(H,20,21);1H |
| InChIKey | OGYYTTAOACHTHC-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.83 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |