C20H19N3O4 — CID 47063435
N-[[2-(4-ethoxyphenoxy)-4-pyridinyl]methyl]-6-oxo-1H-pyridine-3-carboxamide (PubChem CID 47063435) has the molecular formula C20H19N3O4 and a molecular weight of 365.39 g/mol. Its IUPAC name is N-[[2-(4-ethoxyphenoxy)-4-pyridinyl]methyl]-6-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-[[2-(4-ethoxyphenoxy)-4-pyridinyl]methyl]-6-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 47063435 |
| Molecular Formula | C20H19N3O4 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | N-[[2-(4-ethoxyphenoxy)-4-pyridinyl]methyl]-6-oxo-1H-pyridine-3-carboxamide |
| SMILES | CCOc1ccc(Oc2cc(CNC(=O)c3ccc(=O)[nH]c3)ccn2)cc1 |
| InChI | InChI=1S/C20H19N3O4/c1-2-26-16-4-6-17(7-5-16)27-19-11-14(9-10-21-19)12-23-20(25)15-3-8-18(24)22-13-15/h3-11,13H,2,12H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | YLYNVOPBPIQENK-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |