C27H28FN3O4 — CID 55888074
N-[[2-(4-ethoxyphenoxy)-4-pyridinyl]methyl]-1-(4-fluorobenzoyl)piperidine-4-carboxamide (PubChem CID 55888074) has the molecular formula C27H28FN3O4 and a molecular weight of 477.54 g/mol. Its IUPAC name is N-[[2-(4-ethoxyphenoxy)-4-pyridinyl]methyl]-1-(4-fluorobenzoyl)piperidine-4-carboxamide.
| Compound Name | N-[[2-(4-ethoxyphenoxy)-4-pyridinyl]methyl]-1-(4-fluorobenzoyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55888074 |
| Molecular Formula | C27H28FN3O4 |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | N-[[2-(4-ethoxyphenoxy)-4-pyridinyl]methyl]-1-(4-fluorobenzoyl)piperidine-4-carboxamide |
| SMILES | CCOc1ccc(Oc2cc(CNC(=O)C3CCN(C(=O)c4ccc(F)cc4)CC3)ccn2)cc1 |
| InChI | InChI=1S/C27H28FN3O4/c1-2-34-23-7-9-24(10-8-23)35-25-17-19(11-14-29-25)18-30-26(32)20-12-15-31(16-13-20)27(33)21-3-5-22(28)6-4-21/h3-11,14,17,20H,2,12-13,15-16,18H2,1H3,(H,30,32) |
| InChIKey | ZFEDAFXBCYIDGJ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |