C21H21N3O6S — CID 55914573
N-[[2-(4-ethoxyphenoxy)-4-pyridinyl]methyl]-2-methyl-6-nitrobenzenesulfonamide (PubChem CID 55914573) has the molecular formula C21H21N3O6S and a molecular weight of 443.48 g/mol. Its IUPAC name is N-[[2-(4-ethoxyphenoxy)-4-pyridinyl]methyl]-2-methyl-6-nitrobenzenesulfonamide.
| Compound Name | N-[[2-(4-ethoxyphenoxy)-4-pyridinyl]methyl]-2-methyl-6-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 55914573 |
| Molecular Formula | C21H21N3O6S |
| Molecular Weight | 443.48 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | N-[[2-(4-ethoxyphenoxy)-4-pyridinyl]methyl]-2-methyl-6-nitrobenzenesulfonamide |
| SMILES | CCOc1ccc(Oc2cc(CNS(=O)(=O)c3c(C)cccc3[N+](=O)[O-])ccn2)cc1 |
| InChI | InChI=1S/C21H21N3O6S/c1-3-29-17-7-9-18(10-8-17)30-20-13-16(11-12-22-20)14-23-31(27,28)21-15(2)5-4-6-19(21)24(25)26/h4-13,23H,3,14H2,1-2H3 |
| InChIKey | OPSAJFUFCZTCKD-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 120.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.48 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|