C18H12F4N2O3S — CID 51130893
2,3,4-trifluoro-N-[[2-(4-fluorophenoxy)-4-pyridinyl]methyl]benzenesulfonamide (PubChem CID 51130893) has the molecular formula C18H12F4N2O3S and a molecular weight of 412.36 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-[[2-(4-fluorophenoxy)-4-pyridinyl]methyl]benzenesulfonamide.
| Compound Name | 2,3,4-trifluoro-N-[[2-(4-fluorophenoxy)-4-pyridinyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 51130893 |
| Molecular Formula | C18H12F4N2O3S |
| Molecular Weight | 412.36 g/mol |
| Exact Mass | 412.05 |
| IUPAC Name | 2,3,4-trifluoro-N-[[2-(4-fluorophenoxy)-4-pyridinyl]methyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCc1ccnc(Oc2ccc(F)cc2)c1)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C18H12F4N2O3S/c19-12-1-3-13(4-2-12)27-16-9-11(7-8-23-16)10-24-28(25,26)15-6-5-14(20)17(21)18(15)22/h1-9,24H,10H2 |
| InChIKey | QQEJCMRMAFJRHS-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.36 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|