C10H14N2O5S3 — CID 82842535
2-[2-(methylsulfonylmethylsulfonylamino)phenoxy]ethanethioamide (PubChem CID 82842535) has the molecular formula C10H14N2O5S3 and a molecular weight of 338.43 g/mol. Its IUPAC name is 2-[2-(methylsulfonylmethylsulfonylamino)phenoxy]ethanethioamide.
| Compound Name | 2-[2-(methylsulfonylmethylsulfonylamino)phenoxy]ethanethioamide |
|---|---|
| PubChem CID | 82842535 |
| Molecular Formula | C10H14N2O5S3 |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.01 |
| IUPAC Name | 2-[2-(methylsulfonylmethylsulfonylamino)phenoxy]ethanethioamide |
| SMILES | CS(=O)(=O)CS(=O)(=O)Nc1ccccc1OCC(N)=S |
| InChI | InChI=1S/C10H14N2O5S3/c1-19(13,14)7-20(15,16)12-8-4-2-3-5-9(8)17-6-10(11)18/h2-5,12H,6-7H2,1H3,(H2,11,18) |
| InChIKey | MUNIIZDXAPXUFD-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|