C12H17FN2O5S — CID 106169656
4-fluoro-N-(1-hydroxy-3-methylpentan-3-yl)-3-nitrobenzenesulfonamide (PubChem CID 106169656) has the molecular formula C12H17FN2O5S and a molecular weight of 320.34 g/mol. Its IUPAC name is 4-fluoro-N-(1-hydroxy-3-methylpentan-3-yl)-3-nitrobenzenesulfonamide.
| Compound Name | 4-fluoro-N-(1-hydroxy-3-methylpentan-3-yl)-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 106169656 |
| Molecular Formula | C12H17FN2O5S |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 4-fluoro-N-(1-hydroxy-3-methylpentan-3-yl)-3-nitrobenzenesulfonamide |
| SMILES | CCC(C)(CCO)NS(=O)(=O)c1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H17FN2O5S/c1-3-12(2,6-7-16)14-21(19,20)9-4-5-10(13)11(8-9)15(17)18/h4-5,8,14,16H,3,6-7H2,1-2H3 |
| InChIKey | KZMKFFCFKLBDLD-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|