C12H20N4O4S — CID 106330104
4-hydrazinyl-N-(3-methylpentan-3-yl)-3-nitrobenzenesulfonamide (PubChem CID 106330104) has the molecular formula C12H20N4O4S and a molecular weight of 316.38 g/mol. Its IUPAC name is 4-hydrazinyl-N-(3-methylpentan-3-yl)-3-nitrobenzenesulfonamide.
| Compound Name | 4-hydrazinyl-N-(3-methylpentan-3-yl)-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 106330104 |
| Molecular Formula | C12H20N4O4S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 4-hydrazinyl-N-(3-methylpentan-3-yl)-3-nitrobenzenesulfonamide |
| SMILES | CCC(C)(CC)NS(=O)(=O)c1ccc(NN)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H20N4O4S/c1-4-12(3,5-2)15-21(19,20)9-6-7-10(14-13)11(8-9)16(17)18/h6-8,14-15H,4-5,13H2,1-3H3 |
| InChIKey | PQUFUSNIDZAVDO-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 127.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|