C12H18FNO5S2 — CID 104760016
2-fluoro-N-(2-methoxy-2-methylpropyl)-5-methylsulfonylbenzenesulfonamide (PubChem CID 104760016) has the molecular formula C12H18FNO5S2 and a molecular weight of 339.41 g/mol. Its IUPAC name is 2-fluoro-N-(2-methoxy-2-methylpropyl)-5-methylsulfonylbenzenesulfonamide.
| Compound Name | 2-fluoro-N-(2-methoxy-2-methylpropyl)-5-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 104760016 |
| Molecular Formula | C12H18FNO5S2 |
| Molecular Weight | 339.41 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | 2-fluoro-N-(2-methoxy-2-methylpropyl)-5-methylsulfonylbenzenesulfonamide |
| SMILES | COC(C)(C)CNS(=O)(=O)c1cc(S(C)(=O)=O)ccc1F |
| InChI | InChI=1S/C12H18FNO5S2/c1-12(2,19-3)8-14-21(17,18)11-7-9(20(4,15)16)5-6-10(11)13/h5-7,14H,8H2,1-4H3 |
| InChIKey | RHLOIRKFCOUWFE-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.41 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |