C8H12ClN3O2S — CID 83012665
4-amino-2-chloro-N',N'-dimethylbenzenesulfonohydrazide (PubChem CID 83012665) has the molecular formula C8H12ClN3O2S and a molecular weight of 249.72 g/mol. Its IUPAC name is 4-amino-2-chloro-N',N'-dimethylbenzenesulfonohydrazide.
| Compound Name | 4-amino-2-chloro-N',N'-dimethylbenzenesulfonohydrazide |
|---|---|
| PubChem CID | 83012665 |
| Molecular Formula | C8H12ClN3O2S |
| Molecular Weight | 249.72 g/mol |
| Exact Mass | 249.03 |
| IUPAC Name | 4-amino-2-chloro-N',N'-dimethylbenzenesulfonohydrazide |
| SMILES | CN(C)NS(=O)(=O)c1ccc(N)cc1Cl |
| InChI | InChI=1S/C8H12ClN3O2S/c1-12(2)11-15(13,14)8-4-3-6(10)5-7(8)9/h3-5,11H,10H2,1-2H3 |
| InChIKey | PRIZGYYFERLKSK-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.72 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|