C9H9ClN4O2S — CID 61393032
4-amino-2-chloro-N-(1H-pyrazol-5-yl)benzenesulfonamide (PubChem CID 61393032) has the molecular formula C9H9ClN4O2S and a molecular weight of 272.72 g/mol. Its IUPAC name is 4-amino-2-chloro-N-(1H-pyrazol-5-yl)benzenesulfonamide.
| Compound Name | 4-amino-2-chloro-N-(1H-pyrazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 61393032 |
| Molecular Formula | C9H9ClN4O2S |
| Molecular Weight | 272.72 g/mol |
| Exact Mass | 272.01 |
| IUPAC Name | 4-amino-2-chloro-N-(1H-pyrazol-5-yl)benzenesulfonamide |
| SMILES | Nc1ccc(S(=O)(=O)Nc2ccn[nH]2)c(Cl)c1 |
| InChI | InChI=1S/C9H9ClN4O2S/c10-7-5-6(11)1-2-8(7)17(15,16)14-9-3-4-12-13-9/h1-5H,11H2,(H2,12,13,14) |
| InChIKey | CNVJMLLWXPFKAY-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.72 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|