C9H8Cl2N4O2S — CID 61393048
4-amino-2,6-dichloro-N-(1H-pyrazol-5-yl)benzenesulfonamide (PubChem CID 61393048) has the molecular formula C9H8Cl2N4O2S and a molecular weight of 307.16 g/mol. Its IUPAC name is 4-amino-2,6-dichloro-N-(1H-pyrazol-5-yl)benzenesulfonamide.
| Compound Name | 4-amino-2,6-dichloro-N-(1H-pyrazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 61393048 |
| Molecular Formula | C9H8Cl2N4O2S |
| Molecular Weight | 307.16 g/mol |
| Exact Mass | 305.97 |
| IUPAC Name | 4-amino-2,6-dichloro-N-(1H-pyrazol-5-yl)benzenesulfonamide |
| SMILES | Nc1cc(Cl)c(S(=O)(=O)Nc2ccn[nH]2)c(Cl)c1 |
| InChI | InChI=1S/C9H8Cl2N4O2S/c10-6-3-5(12)4-7(11)9(6)18(16,17)15-8-1-2-13-14-8/h1-4H,12H2,(H2,13,14,15) |
| InChIKey | AXTHSLWZBOCBKB-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.16 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|