C10H17N3O3 — CID 104621843
2-hydroxyethyl N-(5-tert-butyl-1H-pyrazol-3-yl)carbamate (PubChem CID 104621843) has the molecular formula C10H17N3O3 and a molecular weight of 227.26 g/mol. Its IUPAC name is 2-hydroxyethyl N-(5-tert-butyl-1H-pyrazol-3-yl)carbamate.
| Compound Name | 2-hydroxyethyl N-(5-tert-butyl-1H-pyrazol-3-yl)carbamate |
|---|---|
| PubChem CID | 104621843 |
| Molecular Formula | C10H17N3O3 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 2-hydroxyethyl N-(5-tert-butyl-1H-pyrazol-3-yl)carbamate |
| SMILES | CC(C)(C)c1cc(NC(=O)OCCO)n[nH]1 |
| InChI | InChI=1S/C10H17N3O3/c1-10(2,3)7-6-8(13-12-7)11-9(15)16-5-4-14/h6,14H,4-5H2,1-3H3,(H2,11,12,13,15) |
| InChIKey | KQPYYAALFNEQKI-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |