C13H21N3O3 — CID 113226291
ethyl 4-[(5-tert-butyl-1H-pyrazol-3-yl)amino]-4-oxobutanoate (PubChem CID 113226291) has the molecular formula C13H21N3O3 and a molecular weight of 267.33 g/mol. Its IUPAC name is ethyl 4-[(5-tert-butyl-1H-pyrazol-3-yl)amino]-4-oxobutanoate.
| Compound Name | ethyl 4-[(5-tert-butyl-1H-pyrazol-3-yl)amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 113226291 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | ethyl 4-[(5-tert-butyl-1H-pyrazol-3-yl)amino]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)Nc1cc(C(C)(C)C)[nH]n1 |
| InChI | InChI=1S/C13H21N3O3/c1-5-19-12(18)7-6-11(17)14-10-8-9(15-16-10)13(2,3)4/h8H,5-7H2,1-4H3,(H2,14,15,16,17) |
| InChIKey | ABWXOXHKDMYGRI-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |