C12H11BrN2O5S — CID 81393153
5-bromo-4-[[(1S)-1-pyridin-2-ylethyl]sulfamoyl]furan-2-carboxylic acid (PubChem CID 81393153) has the molecular formula C12H11BrN2O5S and a molecular weight of 375.20 g/mol. Its IUPAC name is 5-bromo-4-[[(1S)-1-pyridin-2-ylethyl]sulfamoyl]furan-2-carboxylic acid.
| Compound Name | 5-bromo-4-[[(1S)-1-pyridin-2-ylethyl]sulfamoyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 81393153 |
| Molecular Formula | C12H11BrN2O5S |
| Molecular Weight | 375.20 g/mol |
| Exact Mass | 373.96 |
| IUPAC Name | 5-bromo-4-[[(1S)-1-pyridin-2-ylethyl]sulfamoyl]furan-2-carboxylic acid |
| SMILES | C[C@H](NS(=O)(=O)c1cc(C(=O)O)oc1Br)c1ccccn1 |
| InChI | InChI=1S/C12H11BrN2O5S/c1-7(8-4-2-3-5-14-8)15-21(18,19)10-6-9(12(16)17)20-11(10)13/h2-7,15H,1H3,(H,16,17)/t7-/m0/s1 |
| InChIKey | MDEALYPZLDUFGJ-ZETCQYMHSA-N |
| XLogP | 2.17 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.20 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |