C9H9F4NO2S — CID 106294365
3-[(2,2,3,3-tetrafluoropropylamino)methyl]thiophene-2-carboxylic acid (PubChem CID 106294365) has the molecular formula C9H9F4NO2S and a molecular weight of 271.24 g/mol. Its IUPAC name is 3-[(2,2,3,3-tetrafluoropropylamino)methyl]thiophene-2-carboxylic acid.
| Compound Name | 3-[(2,2,3,3-tetrafluoropropylamino)methyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 106294365 |
| Molecular Formula | C9H9F4NO2S |
| Molecular Weight | 271.24 g/mol |
| Exact Mass | 271.03 |
| IUPAC Name | 3-[(2,2,3,3-tetrafluoropropylamino)methyl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1sccc1CNCC(F)(F)C(F)F |
| InChI | InChI=1S/C9H9F4NO2S/c10-8(11)9(12,13)4-14-3-5-1-2-17-6(5)7(15)16/h1-2,8,14H,3-4H2,(H,15,16) |
| InChIKey | MBMKHKXJCYEBEF-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.24 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|