C12H19NO6S2 — CID 61060900
3-[2-methoxyethyl(1-methoxypropan-2-yl)sulfamoyl]thiophene-2-carboxylic acid (PubChem CID 61060900) has the molecular formula C12H19NO6S2 and a molecular weight of 337.42 g/mol. Its IUPAC name is 3-[2-methoxyethyl(1-methoxypropan-2-yl)sulfamoyl]thiophene-2-carboxylic acid.
| Compound Name | 3-[2-methoxyethyl(1-methoxypropan-2-yl)sulfamoyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 61060900 |
| Molecular Formula | C12H19NO6S2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 3-[2-methoxyethyl(1-methoxypropan-2-yl)sulfamoyl]thiophene-2-carboxylic acid |
| SMILES | COCCN(C(C)COC)S(=O)(=O)c1ccsc1C(=O)O |
| InChI | InChI=1S/C12H19NO6S2/c1-9(8-19-3)13(5-6-18-2)21(16,17)10-4-7-20-11(10)12(14)15/h4,7,9H,5-6,8H2,1-3H3,(H,14,15) |
| InChIKey | FIBAXLQDPBMFAC-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |