C11H14N2O7S — CID 115992016
3-[4-[(2-amino-2-oxoethoxy)sulfamoyl]phenoxy]propanoic acid (PubChem CID 115992016) has the molecular formula C11H14N2O7S and a molecular weight of 318.31 g/mol. Its IUPAC name is 3-[4-[(2-amino-2-oxoethoxy)sulfamoyl]phenoxy]propanoic acid.
| Compound Name | 3-[4-[(2-amino-2-oxoethoxy)sulfamoyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 115992016 |
| Molecular Formula | C11H14N2O7S |
| Molecular Weight | 318.31 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 3-[4-[(2-amino-2-oxoethoxy)sulfamoyl]phenoxy]propanoic acid |
| SMILES | NC(=O)CONS(=O)(=O)c1ccc(OCCC(=O)O)cc1 |
| InChI | InChI=1S/C11H14N2O7S/c12-10(14)7-20-13-21(17,18)9-3-1-8(2-4-9)19-6-5-11(15)16/h1-4,13H,5-7H2,(H2,12,14)(H,15,16) |
| InChIKey | JIIDBGASEKBBPX-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 145.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.31 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|