C10H11NO7S — CID 150735824
3-[(4-methoxyphenyl)sulfonylamino]oxy-3-oxopropanoic acid (PubChem CID 150735824) has the molecular formula C10H11NO7S and a molecular weight of 289.27 g/mol. Its IUPAC name is 3-[(4-methoxyphenyl)sulfonylamino]oxy-3-oxopropanoic acid.
| Compound Name | 3-[(4-methoxyphenyl)sulfonylamino]oxy-3-oxopropanoic acid |
|---|---|
| PubChem CID | 150735824 |
| Molecular Formula | C10H11NO7S |
| Molecular Weight | 289.27 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | 3-[(4-methoxyphenyl)sulfonylamino]oxy-3-oxopropanoic acid |
| SMILES | COc1ccc(S(=O)(=O)NOC(=O)CC(=O)O)cc1 |
| InChI | InChI=1S/C10H11NO7S/c1-17-7-2-4-8(5-3-7)19(15,16)11-18-10(14)6-9(12)13/h2-5,11H,6H2,1H3,(H,12,13) |
| InChIKey | JSUOCXLXIJHDKE-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.27 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|