C23H27N3O3S — CID 42349121
N-cyclohexyl-N-(2-hydroxyethyl)-1,3-diphenylpyrazole-4-sulfonamide (PubChem CID 42349121) has the molecular formula C23H27N3O3S and a molecular weight of 425.55 g/mol. Its IUPAC name is N-cyclohexyl-N-(2-hydroxyethyl)-1,3-diphenylpyrazole-4-sulfonamide.
| Compound Name | N-cyclohexyl-N-(2-hydroxyethyl)-1,3-diphenylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 42349121 |
| Molecular Formula | C23H27N3O3S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | N-cyclohexyl-N-(2-hydroxyethyl)-1,3-diphenylpyrazole-4-sulfonamide |
| SMILES | O=S(=O)(c1cn(-c2ccccc2)nc1-c1ccccc1)N(CCO)C1CCCCC1 |
| InChI | InChI=1S/C23H27N3O3S/c27-17-16-26(21-14-8-3-9-15-21)30(28,29)22-18-25(20-12-6-2-7-13-20)24-23(22)19-10-4-1-5-11-19/h1-2,4-7,10-13,18,21,27H,3,8-9,14-17H2 |
| InChIKey | GQHFHRHVWSNKTI-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |