C19H21N3O4S — CID 42349187
N-[2-(2-hydroxyethoxy)ethyl]-1,3-diphenylpyrazole-4-sulfonamide (PubChem CID 42349187) has the molecular formula C19H21N3O4S and a molecular weight of 387.46 g/mol. Its IUPAC name is N-[2-(2-hydroxyethoxy)ethyl]-1,3-diphenylpyrazole-4-sulfonamide.
| Compound Name | N-[2-(2-hydroxyethoxy)ethyl]-1,3-diphenylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 42349187 |
| Molecular Formula | C19H21N3O4S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | N-[2-(2-hydroxyethoxy)ethyl]-1,3-diphenylpyrazole-4-sulfonamide |
| SMILES | O=S(=O)(NCCOCCO)c1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C19H21N3O4S/c23-12-14-26-13-11-20-27(24,25)18-15-22(17-9-5-2-6-10-17)21-19(18)16-7-3-1-4-8-16/h1-10,15,20,23H,11-14H2 |
| InChIKey | MPNDLENCWPHPAD-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|