C16H24N4O2S — CID 42346316
N-[2-(dimethylamino)ethyl]-3-phenyl-1-propan-2-ylpyrazole-4-sulfonamide (PubChem CID 42346316) has the molecular formula C16H24N4O2S and a molecular weight of 336.46 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-3-phenyl-1-propan-2-ylpyrazole-4-sulfonamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-3-phenyl-1-propan-2-ylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 42346316 |
| Molecular Formula | C16H24N4O2S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-3-phenyl-1-propan-2-ylpyrazole-4-sulfonamide |
| SMILES | CC(C)n1cc(S(=O)(=O)NCCN(C)C)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C16H24N4O2S/c1-13(2)20-12-15(23(21,22)17-10-11-19(3)4)16(18-20)14-8-6-5-7-9-14/h5-9,12-13,17H,10-11H2,1-4H3 |
| InChIKey | YRAVDRPAXXAJQE-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |