C16H32N4O2S — CID 42283812
3-tert-butyl-N-[2-(diethylamino)ethyl]-1-propan-2-ylpyrazole-4-sulfonamide (PubChem CID 42283812) has the molecular formula C16H32N4O2S and a molecular weight of 344.53 g/mol. Its IUPAC name is 3-tert-butyl-N-[2-(diethylamino)ethyl]-1-propan-2-ylpyrazole-4-sulfonamide.
| Compound Name | 3-tert-butyl-N-[2-(diethylamino)ethyl]-1-propan-2-ylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 42283812 |
| Molecular Formula | C16H32N4O2S |
| Molecular Weight | 344.53 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | 3-tert-butyl-N-[2-(diethylamino)ethyl]-1-propan-2-ylpyrazole-4-sulfonamide |
| SMILES | CCN(CC)CCNS(=O)(=O)c1cn(C(C)C)nc1C(C)(C)C |
| InChI | InChI=1S/C16H32N4O2S/c1-8-19(9-2)11-10-17-23(21,22)14-12-20(13(3)4)18-15(14)16(5,6)7/h12-13,17H,8-11H2,1-7H3 |
| InChIKey | PBYBKTHVNMVYOT-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.53 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |