C14H27N3O4S — CID 42283804
3-tert-butyl-N-[2-(2-hydroxyethoxy)ethyl]-1-propan-2-ylpyrazole-4-sulfonamide (PubChem CID 42283804) has the molecular formula C14H27N3O4S and a molecular weight of 333.45 g/mol. Its IUPAC name is 3-tert-butyl-N-[2-(2-hydroxyethoxy)ethyl]-1-propan-2-ylpyrazole-4-sulfonamide.
| Compound Name | 3-tert-butyl-N-[2-(2-hydroxyethoxy)ethyl]-1-propan-2-ylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 42283804 |
| Molecular Formula | C14H27N3O4S |
| Molecular Weight | 333.45 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 3-tert-butyl-N-[2-(2-hydroxyethoxy)ethyl]-1-propan-2-ylpyrazole-4-sulfonamide |
| SMILES | CC(C)n1cc(S(=O)(=O)NCCOCCO)c(C(C)(C)C)n1 |
| InChI | InChI=1S/C14H27N3O4S/c1-11(2)17-10-12(13(16-17)14(3,4)5)22(19,20)15-6-8-21-9-7-18/h10-11,15,18H,6-9H2,1-5H3 |
| InChIKey | YMBNVMAKABFLEB-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.45 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|