C17H25N3O2S2 — CID 42283972
3-tert-butyl-N-(3-methylsulfanylphenyl)-1-propan-2-ylpyrazole-4-sulfonamide (PubChem CID 42283972) has the molecular formula C17H25N3O2S2 and a molecular weight of 367.54 g/mol. Its IUPAC name is 3-tert-butyl-N-(3-methylsulfanylphenyl)-1-propan-2-ylpyrazole-4-sulfonamide.
| Compound Name | 3-tert-butyl-N-(3-methylsulfanylphenyl)-1-propan-2-ylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 42283972 |
| Molecular Formula | C17H25N3O2S2 |
| Molecular Weight | 367.54 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 3-tert-butyl-N-(3-methylsulfanylphenyl)-1-propan-2-ylpyrazole-4-sulfonamide |
| SMILES | CSc1cccc(NS(=O)(=O)c2cn(C(C)C)nc2C(C)(C)C)c1 |
| InChI | InChI=1S/C17H25N3O2S2/c1-12(2)20-11-15(16(18-20)17(3,4)5)24(21,22)19-13-8-7-9-14(10-13)23-6/h7-12,19H,1-6H3 |
| InChIKey | KFNPMPWVHAEUOI-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.54 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |