C14H28N4O2S — CID 42283810
3-tert-butyl-N-[2-(dimethylamino)ethyl]-1-propan-2-ylpyrazole-4-sulfonamide (PubChem CID 42283810) has the molecular formula C14H28N4O2S and a molecular weight of 316.47 g/mol. Its IUPAC name is 3-tert-butyl-N-[2-(dimethylamino)ethyl]-1-propan-2-ylpyrazole-4-sulfonamide.
| Compound Name | 3-tert-butyl-N-[2-(dimethylamino)ethyl]-1-propan-2-ylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 42283810 |
| Molecular Formula | C14H28N4O2S |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 3-tert-butyl-N-[2-(dimethylamino)ethyl]-1-propan-2-ylpyrazole-4-sulfonamide |
| SMILES | CC(C)n1cc(S(=O)(=O)NCCN(C)C)c(C(C)(C)C)n1 |
| InChI | InChI=1S/C14H28N4O2S/c1-11(2)18-10-12(13(16-18)14(3,4)5)21(19,20)15-8-9-17(6)7/h10-11,15H,8-9H2,1-7H3 |
| InChIKey | RHRVLEFBPDSNPB-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |