C14H27N3O2S — CID 42283787
N-butyl-3-tert-butyl-1-propan-2-ylpyrazole-4-sulfonamide (PubChem CID 42283787) has the molecular formula C14H27N3O2S and a molecular weight of 301.46 g/mol. Its IUPAC name is N-butyl-3-tert-butyl-1-propan-2-ylpyrazole-4-sulfonamide.
| Compound Name | N-butyl-3-tert-butyl-1-propan-2-ylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 42283787 |
| Molecular Formula | C14H27N3O2S |
| Molecular Weight | 301.46 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | N-butyl-3-tert-butyl-1-propan-2-ylpyrazole-4-sulfonamide |
| SMILES | CCCCNS(=O)(=O)c1cn(C(C)C)nc1C(C)(C)C |
| InChI | InChI=1S/C14H27N3O2S/c1-7-8-9-15-20(18,19)12-10-17(11(2)3)16-13(12)14(4,5)6/h10-11,15H,7-9H2,1-6H3 |
| InChIKey | CSEGWERJZXXDQG-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.46 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|