C20H29N3O2S — CID 42346854
1-cyclopentyl-3-phenyl-N,N-dipropylpyrazole-4-sulfonamide (PubChem CID 42346854) has the molecular formula C20H29N3O2S and a molecular weight of 375.54 g/mol. Its IUPAC name is 1-cyclopentyl-3-phenyl-N,N-dipropylpyrazole-4-sulfonamide.
| Compound Name | 1-cyclopentyl-3-phenyl-N,N-dipropylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 42346854 |
| Molecular Formula | C20H29N3O2S |
| Molecular Weight | 375.54 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | 1-cyclopentyl-3-phenyl-N,N-dipropylpyrazole-4-sulfonamide |
| SMILES | CCCN(CCC)S(=O)(=O)c1cn(C2CCCC2)nc1-c1ccccc1 |
| InChI | InChI=1S/C20H29N3O2S/c1-3-14-22(15-4-2)26(24,25)19-16-23(18-12-8-9-13-18)21-20(19)17-10-6-5-7-11-17/h5-7,10-11,16,18H,3-4,8-9,12-15H2,1-2H3 |
| InChIKey | DOFBQXAKNZNPOS-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.54 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |