C23H27N3O2S — CID 42346901
N-benzyl-1-cyclopentyl-N-ethyl-3-phenylpyrazole-4-sulfonamide (PubChem CID 42346901) has the molecular formula C23H27N3O2S and a molecular weight of 409.56 g/mol. Its IUPAC name is N-benzyl-1-cyclopentyl-N-ethyl-3-phenylpyrazole-4-sulfonamide.
| Compound Name | N-benzyl-1-cyclopentyl-N-ethyl-3-phenylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 42346901 |
| Molecular Formula | C23H27N3O2S |
| Molecular Weight | 409.56 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | N-benzyl-1-cyclopentyl-N-ethyl-3-phenylpyrazole-4-sulfonamide |
| SMILES | CCN(Cc1ccccc1)S(=O)(=O)c1cn(C2CCCC2)nc1-c1ccccc1 |
| InChI | InChI=1S/C23H27N3O2S/c1-2-25(17-19-11-5-3-6-12-19)29(27,28)22-18-26(21-15-9-10-16-21)24-23(22)20-13-7-4-8-14-20/h3-8,11-14,18,21H,2,9-10,15-17H2,1H3 |
| InChIKey | YWUDJEBJKNGELJ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.56 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |