C21H15Br2N3OS — CID 19288857
4,5-dibromo-N-[(1,3-diphenylpyrazol-4-yl)methyl]thiophene-2-carboxamide (PubChem CID 19288857) has the molecular formula C21H15Br2N3OS and a molecular weight of 517.25 g/mol. Its IUPAC name is 4,5-dibromo-N-[(1,3-diphenylpyrazol-4-yl)methyl]thiophene-2-carboxamide.
| Compound Name | 4,5-dibromo-N-[(1,3-diphenylpyrazol-4-yl)methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 19288857 |
| Molecular Formula | C21H15Br2N3OS |
| Molecular Weight | 517.25 g/mol |
| Exact Mass | 514.93 |
| IUPAC Name | 4,5-dibromo-N-[(1,3-diphenylpyrazol-4-yl)methyl]thiophene-2-carboxamide |
| SMILES | O=C(NCc1cn(-c2ccccc2)nc1-c1ccccc1)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C21H15Br2N3OS/c22-17-11-18(28-20(17)23)21(27)24-12-15-13-26(16-9-5-2-6-10-16)25-19(15)14-7-3-1-4-8-14/h1-11,13H,12H2,(H,24,27) |
| InChIKey | NRVCGXGBJXYABY-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.25 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |