C25H23N3O2 — CID 17457554
(E)-N-[(1,3-diphenylpyrazol-4-yl)methyl]-N-methyl-3-(5-methylfuran-2-yl)prop-2-enamide (PubChem CID 17457554) has the molecular formula C25H23N3O2 and a molecular weight of 397.48 g/mol. Its IUPAC name is (E)-N-[(1,3-diphenylpyrazol-4-yl)methyl]-N-methyl-3-(5-methylfuran-2-yl)prop-2-enamide.
| Compound Name | (E)-N-[(1,3-diphenylpyrazol-4-yl)methyl]-N-methyl-3-(5-methylfuran-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 17457554 |
| Molecular Formula | C25H23N3O2 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | (E)-N-[(1,3-diphenylpyrazol-4-yl)methyl]-N-methyl-3-(5-methylfuran-2-yl)prop-2-enamide |
| SMILES | Cc1ccc(/C=C/C(=O)N(C)Cc2cn(-c3ccccc3)nc2-c2ccccc2)o1 |
| InChI | InChI=1S/C25H23N3O2/c1-19-13-14-23(30-19)15-16-24(29)27(2)17-21-18-28(22-11-7-4-8-12-22)26-25(21)20-9-5-3-6-10-20/h3-16,18H,17H2,1-2H3/b16-15+ |
| InChIKey | DKDYJCGJSWTVGT-FOCLMDBBSA-N |
| XLogP | 5.11 |
| TPSA | 51.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|