C27H22N4O — CID 17457526
(E)-3-(4-cyanophenyl)-N-[(1,3-diphenylpyrazol-4-yl)methyl]-N-methylprop-2-enamide (PubChem CID 17457526) has the molecular formula C27H22N4O and a molecular weight of 418.50 g/mol. Its IUPAC name is (E)-3-(4-cyanophenyl)-N-[(1,3-diphenylpyrazol-4-yl)methyl]-N-methylprop-2-enamide.
| Compound Name | (E)-3-(4-cyanophenyl)-N-[(1,3-diphenylpyrazol-4-yl)methyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 17457526 |
| Molecular Formula | C27H22N4O |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | (E)-3-(4-cyanophenyl)-N-[(1,3-diphenylpyrazol-4-yl)methyl]-N-methylprop-2-enamide |
| SMILES | CN(Cc1cn(-c2ccccc2)nc1-c1ccccc1)C(=O)/C=C/c1ccc(C#N)cc1 |
| InChI | InChI=1S/C27H22N4O/c1-30(26(32)17-16-21-12-14-22(18-28)15-13-21)19-24-20-31(25-10-6-3-7-11-25)29-27(24)23-8-4-2-5-9-23/h2-17,20H,19H2,1H3/b17-16+ |
| InChIKey | PFODFLYTLQJUJT-WUKNDPDISA-N |
| XLogP | 5.08 |
| TPSA | 61.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|