C20H27N3O2 — CID 46961418
4-[[3-morpholin-4-ylpropyl(pyridin-3-ylmethyl)amino]methyl]phenol (PubChem CID 46961418) has the molecular formula C20H27N3O2 and a molecular weight of 341.45 g/mol. Its IUPAC name is 4-[[3-morpholin-4-ylpropyl(pyridin-3-ylmethyl)amino]methyl]phenol.
| Compound Name | 4-[[3-morpholin-4-ylpropyl(pyridin-3-ylmethyl)amino]methyl]phenol |
|---|---|
| PubChem CID | 46961418 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | 4-[[3-morpholin-4-ylpropyl(pyridin-3-ylmethyl)amino]methyl]phenol |
| SMILES | Oc1ccc(CN(CCCN2CCOCC2)Cc2cccnc2)cc1 |
| InChI | InChI=1S/C20H27N3O2/c24-20-6-4-18(5-7-20)16-23(17-19-3-1-8-21-15-19)10-2-9-22-11-13-25-14-12-22/h1,3-8,15,24H,2,9-14,16-17H2 |
| InChIKey | NYMVPJYCHDXHOF-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 48.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |