C16H27N3O — CID 107367226
N'-benzyl-N'-(2-morpholin-4-ylethyl)propane-1,3-diamine (PubChem CID 107367226) has the molecular formula C16H27N3O and a molecular weight of 277.41 g/mol. Its IUPAC name is N'-benzyl-N'-(2-morpholin-4-ylethyl)propane-1,3-diamine.
| Compound Name | N'-benzyl-N'-(2-morpholin-4-ylethyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 107367226 |
| Molecular Formula | C16H27N3O |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.22 |
| IUPAC Name | N'-benzyl-N'-(2-morpholin-4-ylethyl)propane-1,3-diamine |
| SMILES | NCCCN(CCN1CCOCC1)Cc1ccccc1 |
| InChI | InChI=1S/C16H27N3O/c17-7-4-8-19(15-16-5-2-1-3-6-16)10-9-18-11-13-20-14-12-18/h1-3,5-6H,4,7-15,17H2 |
| InChIKey | HXMKIIHVKZXGGN-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |