C26H36N4O3S — CID 4154052
ethyl 4-[[[4-(dimethylamino)phenyl]methyl-(3-morpholin-4-ylpropyl)carbamothioyl]amino]benzoate (PubChem CID 4154052) has the molecular formula C26H36N4O3S and a molecular weight of 484.67 g/mol. Its IUPAC name is ethyl 4-[[[4-(dimethylamino)phenyl]methyl-(3-morpholin-4-ylpropyl)carbamothioyl]amino]benzoate.
| Compound Name | ethyl 4-[[[4-(dimethylamino)phenyl]methyl-(3-morpholin-4-ylpropyl)carbamothioyl]amino]benzoate |
|---|---|
| PubChem CID | 4154052 |
| Molecular Formula | C26H36N4O3S |
| Molecular Weight | 484.67 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | ethyl 4-[[[4-(dimethylamino)phenyl]methyl-(3-morpholin-4-ylpropyl)carbamothioyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=S)N(CCCN2CCOCC2)Cc2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C26H36N4O3S/c1-4-33-25(31)22-8-10-23(11-9-22)27-26(34)30(15-5-14-29-16-18-32-19-17-29)20-21-6-12-24(13-7-21)28(2)3/h6-13H,4-5,14-20H2,1-3H3,(H,27,34) |
| InChIKey | PESQVFQIUHJYOR-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 57.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.67 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|